C20H21N3O5 — CID 135340256
ethyl (E)-3-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]prop-2-enoate (PubChem CID 135340256) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is ethyl (E)-3-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 135340256 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | ethyl (E)-3-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1nnc(-c2ccc(C)o2)n1-c1c(OC)cccc1OC |
| InChI | InChI=1S/C20H21N3O5/c1-5-27-18(24)12-11-17-21-22-20(16-10-9-13(2)28-16)23(17)19-14(25-3)7-6-8-15(19)26-4/h6-12H,5H2,1-4H3/b12-11+ |
| InChIKey | QRUUKWIIZOSKIV-VAWYXSNFSA-N |
| XLogP | 3.43 |
| TPSA | 88.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|