C24H25N3O5S — CID 146572306
[4-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]-methoxymethanol (PubChem CID 146572306) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is [4-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]-methoxymethanol.
| Compound Name | [4-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]-methoxymethanol |
|---|---|
| PubChem CID | 146572306 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [4-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]-methoxymethanol |
| SMILES | COc1cccc(OC)c1-n1c(SCc2ccc(C(O)OC)cc2)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C24H25N3O5S/c1-15-8-13-20(32-15)22-25-26-24(27(22)21-18(29-2)6-5-7-19(21)30-3)33-14-16-9-11-17(12-10-16)23(28)31-4/h5-13,23,28H,14H2,1-4H3 |
| InChIKey | RZAUOKNOMFRZHL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|