C21H21N3O6 — CID 140919068
ethyl (E)-4-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-2-oxobut-3-enoate (PubChem CID 140919068) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is ethyl (E)-4-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-2-oxobut-3-enoate.
| Compound Name | ethyl (E)-4-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 140919068 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | ethyl (E)-4-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-2-oxobut-3-enoate |
| SMILES | CCOC(=O)C(=O)/C=C/c1nnc(-c2ccc(C)o2)n1-c1c(OC)cccc1OC |
| InChI | InChI=1S/C21H21N3O6/c1-5-29-21(26)14(25)10-12-18-22-23-20(17-11-9-13(2)30-17)24(18)19-15(27-3)7-6-8-16(19)28-4/h6-12H,5H2,1-4H3/b12-10+ |
| InChIKey | PCQOWYHKNHEEAF-ZRDIBKRKSA-N |
| XLogP | 3.00 |
| TPSA | 105.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|