C17H25N5O6 — CID 135341976
tert-butyl 6-[3-[methoxy(methyl)carbamoyl]-4-nitropyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 135341976) has the molecular formula C17H25N5O6 and a molecular weight of 395.42 g/mol. Its IUPAC name is tert-butyl 6-[3-[methoxy(methyl)carbamoyl]-4-nitropyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[3-[methoxy(methyl)carbamoyl]-4-nitropyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 135341976 |
| Molecular Formula | C17H25N5O6 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | tert-butyl 6-[3-[methoxy(methyl)carbamoyl]-4-nitropyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CON(C)C(=O)c1nn(C2CC3(C2)CN(C(=O)OC(C)(C)C)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N5O6/c1-16(2,3)28-15(24)20-9-17(10-20)6-11(7-17)21-8-12(22(25)26)13(18-21)14(23)19(4)27-5/h8,11H,6-7,9-10H2,1-5H3 |
| InChIKey | YODLROWDYFBZIW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 120.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|