C16H21F5N4O2 — CID 135342036
tert-butyl 6-[4-amino-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 135342036) has the molecular formula C16H21F5N4O2 and a molecular weight of 396.36 g/mol. Its IUPAC name is tert-butyl 6-[4-amino-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[4-amino-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 135342036 |
| Molecular Formula | C16H21F5N4O2 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | tert-butyl 6-[4-amino-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(n3cc(N)c(C(F)(F)C(F)(F)F)n3)C2)C1 |
| InChI | InChI=1S/C16H21F5N4O2/c1-13(2,3)27-12(26)24-7-14(8-24)4-9(5-14)25-6-10(22)11(23-25)15(17,18)16(19,20)21/h6,9H,4-5,7-8,22H2,1-3H3 |
| InChIKey | MHACKRRGUAJSMK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|