C11H14F5N3O2 — CID 140844573
tert-butyl N-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]carbamate (PubChem CID 140844573) has the molecular formula C11H14F5N3O2 and a molecular weight of 315.24 g/mol. Its IUPAC name is tert-butyl N-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 140844573 |
| Molecular Formula | C11H14F5N3O2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | tert-butyl N-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]carbamate |
| SMILES | Cn1cc(NC(=O)OC(C)(C)C)c(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C11H14F5N3O2/c1-9(2,3)21-8(20)17-6-5-19(4)18-7(6)10(12,13)11(14,15)16/h5H,1-4H3,(H,17,20) |
| InChIKey | DCMJFBIEEMDGLW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|