C18H23Cl2N3O2 — CID 135342163
4-[2-chloro-3-(piperidine-1-carbonyl)phenyl]-1,4-diazepane-1-carbonyl chloride (PubChem CID 135342163) has the molecular formula C18H23Cl2N3O2 and a molecular weight of 384.31 g/mol. Its IUPAC name is 4-[2-chloro-3-(piperidine-1-carbonyl)phenyl]-1,4-diazepane-1-carbonyl chloride.
| Compound Name | 4-[2-chloro-3-(piperidine-1-carbonyl)phenyl]-1,4-diazepane-1-carbonyl chloride |
|---|---|
| PubChem CID | 135342163 |
| Molecular Formula | C18H23Cl2N3O2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4-[2-chloro-3-(piperidine-1-carbonyl)phenyl]-1,4-diazepane-1-carbonyl chloride |
| SMILES | O=C(Cl)N1CCCN(c2cccc(C(=O)N3CCCCC3)c2Cl)CC1 |
| InChI | InChI=1S/C18H23Cl2N3O2/c19-16-14(17(24)22-8-2-1-3-9-22)6-4-7-15(16)21-10-5-11-23(13-12-21)18(20)25/h4,6-7H,1-3,5,8-13H2 |
| InChIKey | ZFXZUQHRKJMZOR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|