C29H28Br2ClNO2 — CID 135350000
1-[7-(bromomethoxy)naphthalen-2-yl]-2-(4-bromophenyl)-1-(4-chlorophenyl)-4-(dimethylamino)butan-2-ol (PubChem CID 135350000) has the molecular formula C29H28Br2ClNO2 and a molecular weight of 617.81 g/mol. Its IUPAC name is 1-[7-(bromomethoxy)naphthalen-2-yl]-2-(4-bromophenyl)-1-(4-chlorophenyl)-4-(dimethylamino)butan-2-ol.
| Compound Name | 1-[7-(bromomethoxy)naphthalen-2-yl]-2-(4-bromophenyl)-1-(4-chlorophenyl)-4-(dimethylamino)butan-2-ol |
|---|---|
| PubChem CID | 135350000 |
| Molecular Formula | C29H28Br2ClNO2 |
| Molecular Weight | 617.81 g/mol |
| Exact Mass | 615.02 |
| IUPAC Name | 1-[7-(bromomethoxy)naphthalen-2-yl]-2-(4-bromophenyl)-1-(4-chlorophenyl)-4-(dimethylamino)butan-2-ol |
| SMILES | CN(C)CCC(O)(c1ccc(Br)cc1)C(c1ccc(Cl)cc1)c1ccc2ccc(OCBr)cc2c1 |
| InChI | InChI=1S/C29H28Br2ClNO2/c1-33(2)16-15-29(34,24-8-10-25(31)11-9-24)28(21-5-12-26(32)13-6-21)22-4-3-20-7-14-27(35-19-30)18-23(20)17-22/h3-14,17-18,28,34H,15-16,19H2,1-2H3 |
| InChIKey | CXUZJXMIFJXAGE-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.81 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|