C17H14F2N2O3 — CID 135352308
4-(3,4-difluorophenyl)-2-oxo-N-phenoxypyrrolidine-3-carboxamide (PubChem CID 135352308) has the molecular formula C17H14F2N2O3 and a molecular weight of 332.31 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-oxo-N-phenoxypyrrolidine-3-carboxamide.
| Compound Name | 4-(3,4-difluorophenyl)-2-oxo-N-phenoxypyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 135352308 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-oxo-N-phenoxypyrrolidine-3-carboxamide |
| SMILES | O=C1NCC(c2ccc(F)c(F)c2)C1C(=O)NOc1ccccc1 |
| InChI | InChI=1S/C17H14F2N2O3/c18-13-7-6-10(8-14(13)19)12-9-20-16(22)15(12)17(23)21-24-11-4-2-1-3-5-11/h1-8,12,15H,9H2,(H,20,22)(H,21,23) |
| InChIKey | BCAUKAOPVRFLIH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|