C18H16F3N2O2P — CID 170046491
4-[4-[difluoro(phosphanyl)methyl]phenyl]-N-(2-fluorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 170046491) has the molecular formula C18H16F3N2O2P and a molecular weight of 380.31 g/mol. Its IUPAC name is 4-[4-[difluoro(phosphanyl)methyl]phenyl]-N-(2-fluorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 4-[4-[difluoro(phosphanyl)methyl]phenyl]-N-(2-fluorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 170046491 |
| Molecular Formula | C18H16F3N2O2P |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-[4-[difluoro(phosphanyl)methyl]phenyl]-N-(2-fluorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1NCC(c2ccc(C(F)(F)P)cc2)C1C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C18H16F3N2O2P/c19-13-3-1-2-4-14(13)23-17(25)15-12(9-22-16(15)24)10-5-7-11(8-6-10)18(20,21)26/h1-8,12,15H,9,26H2,(H,22,24)(H,23,25) |
| InChIKey | URRPAGLFWUIWNQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|