C20H17F2N3O2 — CID 134412150
(3R,4S)-N-(2,3-difluorophenyl)-4-(1-methylindol-6-yl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134412150) has the molecular formula C20H17F2N3O2 and a molecular weight of 369.37 g/mol. Its IUPAC name is (3R,4S)-N-(2,3-difluorophenyl)-4-(1-methylindol-6-yl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-(2,3-difluorophenyl)-4-(1-methylindol-6-yl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412150 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (3R,4S)-N-(2,3-difluorophenyl)-4-(1-methylindol-6-yl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cn1ccc2ccc([C@H]3CNC(=O)[C@@H]3C(=O)Nc3cccc(F)c3F)cc21 |
| InChI | InChI=1S/C20H17F2N3O2/c1-25-8-7-11-5-6-12(9-16(11)25)13-10-23-19(26)17(13)20(27)24-15-4-2-3-14(21)18(15)22/h2-9,13,17H,10H2,1H3,(H,23,26)(H,24,27)/t13-,17-/m1/s1 |
| InChIKey | HBOFROWXPLXOFC-CXAGYDPISA-N |
| XLogP | 2.92 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|