C16H12F4N2O2S — CID 134412038
(3R,4S)-4-[5-(difluoromethyl)thiophen-3-yl]-N-(2,3-difluorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134412038) has the molecular formula C16H12F4N2O2S and a molecular weight of 372.34 g/mol. Its IUPAC name is (3R,4S)-4-[5-(difluoromethyl)thiophen-3-yl]-N-(2,3-difluorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-4-[5-(difluoromethyl)thiophen-3-yl]-N-(2,3-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412038 |
| Molecular Formula | C16H12F4N2O2S |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (3R,4S)-4-[5-(difluoromethyl)thiophen-3-yl]-N-(2,3-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1NC[C@H](c2csc(C(F)F)c2)[C@H]1C(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C16H12F4N2O2S/c17-9-2-1-3-10(13(9)18)22-16(24)12-8(5-21-15(12)23)7-4-11(14(19)20)25-6-7/h1-4,6,8,12,14H,5H2,(H,21,23)(H,22,24)/t8-,12-/m1/s1 |
| InChIKey | KRRPKACNWIWIBC-PRHODGIISA-N |
| XLogP | 3.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|