C19H17F3N2O2 — CID 155163703
(3S,4S)-N-(2,3-difluorophenyl)-4-[(4-fluorophenyl)methyl]-2-oxopiperidine-3-carboxamide (PubChem CID 155163703) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is (3S,4S)-N-(2,3-difluorophenyl)-4-[(4-fluorophenyl)methyl]-2-oxopiperidine-3-carboxamide.
| Compound Name | (3S,4S)-N-(2,3-difluorophenyl)-4-[(4-fluorophenyl)methyl]-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 155163703 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (3S,4S)-N-(2,3-difluorophenyl)-4-[(4-fluorophenyl)methyl]-2-oxopiperidine-3-carboxamide |
| SMILES | O=C1NCC[C@H](Cc2ccc(F)cc2)[C@@H]1C(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C19H17F3N2O2/c20-13-6-4-11(5-7-13)10-12-8-9-23-18(25)16(12)19(26)24-15-3-1-2-14(21)17(15)22/h1-7,12,16H,8-10H2,(H,23,25)(H,24,26)/t12-,16+/m1/s1 |
| InChIKey | RYOXJZHMXOUCHW-WBMJQRKESA-N |
| XLogP | 3.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|