C19H19FN2O2 — CID 165061569
(3R,4S)-4-(4-fluorophenyl)-N-(2-methylphenyl)-2-oxopiperidine-3-carboxamide (PubChem CID 165061569) has the molecular formula C19H19FN2O2 and a molecular weight of 326.37 g/mol. Its IUPAC name is (3R,4S)-4-(4-fluorophenyl)-N-(2-methylphenyl)-2-oxopiperidine-3-carboxamide.
| Compound Name | (3R,4S)-4-(4-fluorophenyl)-N-(2-methylphenyl)-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 165061569 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (3R,4S)-4-(4-fluorophenyl)-N-(2-methylphenyl)-2-oxopiperidine-3-carboxamide |
| SMILES | Cc1ccccc1NC(=O)[C@H]1C(=O)NCC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2O2/c1-12-4-2-3-5-16(12)22-19(24)17-15(10-11-21-18(17)23)13-6-8-14(20)9-7-13/h2-9,15,17H,10-11H2,1H3,(H,21,23)(H,22,24)/t15-,17-/m1/s1 |
| InChIKey | RHIKTBRGSXLYQV-NVXWUHKLSA-N |
| XLogP | 2.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|