C18H15ClF2N2O2 — CID 134411721
(3R,4S)-4-(4-chloro-3-methylphenyl)-N-(2,4-difluorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134411721) has the molecular formula C18H15ClF2N2O2 and a molecular weight of 364.78 g/mol. Its IUPAC name is (3R,4S)-4-(4-chloro-3-methylphenyl)-N-(2,4-difluorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-4-(4-chloro-3-methylphenyl)-N-(2,4-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134411721 |
| Molecular Formula | C18H15ClF2N2O2 |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (3R,4S)-4-(4-chloro-3-methylphenyl)-N-(2,4-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cc([C@H]2CNC(=O)[C@@H]2C(=O)Nc2ccc(F)cc2F)ccc1Cl |
| InChI | InChI=1S/C18H15ClF2N2O2/c1-9-6-10(2-4-13(9)19)12-8-22-17(24)16(12)18(25)23-15-5-3-11(20)7-14(15)21/h2-7,12,16H,8H2,1H3,(H,22,24)(H,23,25)/t12-,16-/m1/s1 |
| InChIKey | SAQQPGZMCFNMJV-MLGOLLRUSA-N |
| XLogP | 3.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|