C19H18F2N2O3 — CID 134411875
(3R,4S)-N-(2,4-difluorophenyl)-4-(3-ethoxyphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134411875) has the molecular formula C19H18F2N2O3 and a molecular weight of 360.36 g/mol. Its IUPAC name is (3R,4S)-N-(2,4-difluorophenyl)-4-(3-ethoxyphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-(2,4-difluorophenyl)-4-(3-ethoxyphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134411875 |
| Molecular Formula | C19H18F2N2O3 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (3R,4S)-N-(2,4-difluorophenyl)-4-(3-ethoxyphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1cccc([C@H]2CNC(=O)[C@@H]2C(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H18F2N2O3/c1-2-26-13-5-3-4-11(8-13)14-10-22-18(24)17(14)19(25)23-16-7-6-12(20)9-15(16)21/h3-9,14,17H,2,10H2,1H3,(H,22,24)(H,23,25)/t14-,17-/m1/s1 |
| InChIKey | FMXOCGCNNUKQBM-RHSMWYFYSA-N |
| XLogP | 2.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|