C19H16F4N2O2 — CID 134411708
(3R,4S)-4-[3-(1,1-difluoroethyl)phenyl]-N-(2,3-difluorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134411708) has the molecular formula C19H16F4N2O2 and a molecular weight of 380.34 g/mol. Its IUPAC name is (3R,4S)-4-[3-(1,1-difluoroethyl)phenyl]-N-(2,3-difluorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-4-[3-(1,1-difluoroethyl)phenyl]-N-(2,3-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134411708 |
| Molecular Formula | C19H16F4N2O2 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (3R,4S)-4-[3-(1,1-difluoroethyl)phenyl]-N-(2,3-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CC(F)(F)c1cccc([C@H]2CNC(=O)[C@@H]2C(=O)Nc2cccc(F)c2F)c1 |
| InChI | InChI=1S/C19H16F4N2O2/c1-19(22,23)11-5-2-4-10(8-11)12-9-24-17(26)15(12)18(27)25-14-7-3-6-13(20)16(14)21/h2-8,12,15H,9H2,1H3,(H,24,26)(H,25,27)/t12-,15-/m1/s1 |
| InChIKey | MGMLKEZUYCEBHU-IUODEOHRSA-N |
| XLogP | 3.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|