C19H14F6N2OS — CID 134411972
(3S,4S)-2-sulfanylidene-N-[2-(trifluoromethyl)phenyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 134411972) has the molecular formula C19H14F6N2OS and a molecular weight of 432.39 g/mol. Its IUPAC name is (3S,4S)-2-sulfanylidene-N-[2-(trifluoromethyl)phenyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-2-sulfanylidene-N-[2-(trifluoromethyl)phenyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134411972 |
| Molecular Formula | C19H14F6N2OS |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (3S,4S)-2-sulfanylidene-N-[2-(trifluoromethyl)phenyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)[C@H]1C(=S)NC[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F6N2OS/c20-18(21,22)11-7-5-10(6-8-11)12-9-26-17(29)15(12)16(28)27-14-4-2-1-3-13(14)19(23,24)25/h1-8,12,15H,9H2,(H,26,29)(H,27,28)/t12-,15+/m1/s1 |
| InChIKey | KVUBBKJMMIYTGR-DOMZBBRYSA-N |
| XLogP | 4.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|