C11H9F3N2O4 — CID 142439171
3-hydroxy-5-oxo-N-[2-(trifluoromethyl)phenyl]-1,2-oxazolidine-4-carboxamide (PubChem CID 142439171) has the molecular formula C11H9F3N2O4 and a molecular weight of 290.20 g/mol. Its IUPAC name is 3-hydroxy-5-oxo-N-[2-(trifluoromethyl)phenyl]-1,2-oxazolidine-4-carboxamide.
| Compound Name | 3-hydroxy-5-oxo-N-[2-(trifluoromethyl)phenyl]-1,2-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 142439171 |
| Molecular Formula | C11H9F3N2O4 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-hydroxy-5-oxo-N-[2-(trifluoromethyl)phenyl]-1,2-oxazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)C1C(=O)ONC1O |
| InChI | InChI=1S/C11H9F3N2O4/c12-11(13,14)5-3-1-2-4-6(5)15-8(17)7-9(18)16-20-10(7)19/h1-4,7,9,16,18H,(H,15,17) |
| InChIKey | ABHMTIMGIDIPNU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|