C17H21NO5 — CID 135363406
2-(2-methylprop-2-enoylamino)ethyl 4-butanoyloxybenzoate (PubChem CID 135363406) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoylamino)ethyl 4-butanoyloxybenzoate.
| Compound Name | 2-(2-methylprop-2-enoylamino)ethyl 4-butanoyloxybenzoate |
|---|---|
| PubChem CID | 135363406 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(2-methylprop-2-enoylamino)ethyl 4-butanoyloxybenzoate |
| SMILES | C=C(C)C(=O)NCCOC(=O)c1ccc(OC(=O)CCC)cc1 |
| InChI | InChI=1S/C17H21NO5/c1-4-5-15(19)23-14-8-6-13(7-9-14)17(21)22-11-10-18-16(20)12(2)3/h6-9H,2,4-5,10-11H2,1,3H3,(H,18,20) |
| InChIKey | OBPQOEUYNKDOPG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|