C20H23BrClN3O — CID 135363582
N'-[4-[C-[(3-bromophenoxy)methyl]-N-methylcarbonimidoyl]-2-chloro-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 135363582) has the molecular formula C20H23BrClN3O and a molecular weight of 436.78 g/mol. Its IUPAC name is N'-[4-[C-[(3-bromophenoxy)methyl]-N-methylcarbonimidoyl]-2-chloro-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[C-[(3-bromophenoxy)methyl]-N-methylcarbonimidoyl]-2-chloro-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 135363582 |
| Molecular Formula | C20H23BrClN3O |
| Molecular Weight | 436.78 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N'-[4-[C-[(3-bromophenoxy)methyl]-N-methylcarbonimidoyl]-2-chloro-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(/C(COc2cccc(Br)c2)=N/C)cc1Cl |
| InChI | InChI=1S/C20H23BrClN3O/c1-5-25(4)13-24-19-9-14(2)17(11-18(19)22)20(23-3)12-26-16-8-6-7-15(21)10-16/h6-11,13H,5,12H2,1-4H3/b23-20+,24-13+ |
| InChIKey | CWVMDBGHYUGWOZ-UOWSBTSXSA-N |
| XLogP | 5.52 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.78 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|