C22H28N2O — CID 135367914
1-[(1R,2R)-2-(4-phenylmethoxyphenyl)cyclopropyl]cyclohexane-1,4-diamine (PubChem CID 135367914) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(4-phenylmethoxyphenyl)cyclopropyl]cyclohexane-1,4-diamine.
| Compound Name | 1-[(1R,2R)-2-(4-phenylmethoxyphenyl)cyclopropyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 135367914 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-[(1R,2R)-2-(4-phenylmethoxyphenyl)cyclopropyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(N)([C@@H]2C[C@H]2c2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C22H28N2O/c23-18-10-12-22(24,13-11-18)21-14-20(21)17-6-8-19(9-7-17)25-15-16-4-2-1-3-5-16/h1-9,18,20-21H,10-15,23-24H2/t18?,20-,21+,22?/m0/s1 |
| InChIKey | ZBWUTEIHQKSPQF-KSBZDLFUSA-N |
| XLogP | 3.97 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |