C13H19N5O2 — CID 135370939
ethyl 5-amino-3-ethyl-1-(2-pyrazol-1-ylethyl)pyrazole-4-carboxylate (PubChem CID 135370939) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is ethyl 5-amino-3-ethyl-1-(2-pyrazol-1-ylethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-3-ethyl-1-(2-pyrazol-1-ylethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 135370939 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | ethyl 5-amino-3-ethyl-1-(2-pyrazol-1-ylethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(CC)nn(CCn2cccn2)c1N |
| InChI | InChI=1S/C13H19N5O2/c1-3-10-11(13(19)20-4-2)12(14)18(16-10)9-8-17-7-5-6-15-17/h5-7H,3-4,8-9,14H2,1-2H3 |
| InChIKey | XDWSKYUJKUCSSZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |