C13H16N6O2 — CID 135374471
1-methyl-5-[3-(5-methyl-4-nitropyrazol-1-yl)-6-bicyclo[3.1.0]hexanyl]-1,2,4-triazole (PubChem CID 135374471) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-methyl-5-[3-(5-methyl-4-nitropyrazol-1-yl)-6-bicyclo[3.1.0]hexanyl]-1,2,4-triazole.
| Compound Name | 1-methyl-5-[3-(5-methyl-4-nitropyrazol-1-yl)-6-bicyclo[3.1.0]hexanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 135374471 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-methyl-5-[3-(5-methyl-4-nitropyrazol-1-yl)-6-bicyclo[3.1.0]hexanyl]-1,2,4-triazole |
| SMILES | Cc1c([N+](=O)[O-])cnn1C1CC2C(C1)C2c1ncnn1C |
| InChI | InChI=1S/C13H16N6O2/c1-7-11(19(20)21)5-15-18(7)8-3-9-10(4-8)12(9)13-14-6-16-17(13)2/h5-6,8-10,12H,3-4H2,1-2H3 |
| InChIKey | UVHSULJQWCDOHW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|