C16H17ClFN3O — CID 135374583
3-amino-1-[5-(2-fluorophenyl)-2-pyridinyl]piperidin-2-one;hydrochloride (PubChem CID 135374583) has the molecular formula C16H17ClFN3O and a molecular weight of 321.78 g/mol. Its IUPAC name is 3-amino-1-[5-(2-fluorophenyl)-2-pyridinyl]piperidin-2-one;hydrochloride.
| Compound Name | 3-amino-1-[5-(2-fluorophenyl)-2-pyridinyl]piperidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 135374583 |
| Molecular Formula | C16H17ClFN3O |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-amino-1-[5-(2-fluorophenyl)-2-pyridinyl]piperidin-2-one;hydrochloride |
| SMILES | Cl.NC1CCCN(c2ccc(-c3ccccc3F)cn2)C1=O |
| InChI | InChI=1S/C16H16FN3O.ClH/c17-13-5-2-1-4-12(13)11-7-8-15(19-10-11)20-9-3-6-14(18)16(20)21;/h1-2,4-5,7-8,10,14H,3,6,9,18H2;1H |
| InChIKey | PWICAVWXQFRBAW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |