C23H25ClN4O3 — CID 135378114
4-[[8-chloro-7-[3-(dimethylamino)propoxy]-2-oxo-1H-quinolin-3-yl]methylamino]-2-methoxybenzonitrile (PubChem CID 135378114) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 4-[[8-chloro-7-[3-(dimethylamino)propoxy]-2-oxo-1H-quinolin-3-yl]methylamino]-2-methoxybenzonitrile.
| Compound Name | 4-[[8-chloro-7-[3-(dimethylamino)propoxy]-2-oxo-1H-quinolin-3-yl]methylamino]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 135378114 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 4-[[8-chloro-7-[3-(dimethylamino)propoxy]-2-oxo-1H-quinolin-3-yl]methylamino]-2-methoxybenzonitrile |
| SMILES | COc1cc(NCc2cc3ccc(OCCCN(C)C)c(Cl)c3[nH]c2=O)ccc1C#N |
| InChI | InChI=1S/C23H25ClN4O3/c1-28(2)9-4-10-31-19-8-6-15-11-17(23(29)27-22(15)21(19)24)14-26-18-7-5-16(13-25)20(12-18)30-3/h5-8,11-12,26H,4,9-10,14H2,1-3H3,(H,27,29) |
| InChIKey | BYWFCAJDGWJKQP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|