C18H14ClN3O3 — CID 135378340
4-[(8-chloro-6-hydroxy-2-oxo-1H-quinolin-3-yl)methylamino]-2-methoxybenzonitrile (PubChem CID 135378340) has the molecular formula C18H14ClN3O3 and a molecular weight of 355.78 g/mol. Its IUPAC name is 4-[(8-chloro-6-hydroxy-2-oxo-1H-quinolin-3-yl)methylamino]-2-methoxybenzonitrile.
| Compound Name | 4-[(8-chloro-6-hydroxy-2-oxo-1H-quinolin-3-yl)methylamino]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 135378340 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 4-[(8-chloro-6-hydroxy-2-oxo-1H-quinolin-3-yl)methylamino]-2-methoxybenzonitrile |
| SMILES | COc1cc(NCc2cc3cc(O)cc(Cl)c3[nH]c2=O)ccc1C#N |
| InChI | InChI=1S/C18H14ClN3O3/c1-25-16-6-13(3-2-10(16)8-20)21-9-12-4-11-5-14(23)7-15(19)17(11)22-18(12)24/h2-7,21,23H,9H2,1H3,(H,22,24) |
| InChIKey | JXIFMXOFYMYCOX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |