C26H25N3O — CID 135379616
3-[2,6-di(propan-2-yl)phenyl]-2,5,16-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,10,12,14-heptaen-9-one (PubChem CID 135379616) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-2,5,16-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,10,12,14-heptaen-9-one.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-2,5,16-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,10,12,14-heptaen-9-one |
|---|---|
| PubChem CID | 135379616 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-2,5,16-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,10,12,14-heptaen-9-one |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnc2c3cc(=O)ccc3c3cc[nH]cc3n12 |
| InChI | InChI=1S/C26H25N3O/c1-15(2)18-6-5-7-19(16(3)4)25(18)24-14-28-26-22-12-17(30)8-9-20(22)21-10-11-27-13-23(21)29(24)26/h5-16,27H,1-4H3 |
| InChIKey | RHNWXBMMLRPPFN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|