C13H18F3N3O4S — CID 135386800
(2R)-5-amino-2-(methanesulfonamido)-N-[3-(trifluoromethoxy)phenyl]pentanamide (PubChem CID 135386800) has the molecular formula C13H18F3N3O4S and a molecular weight of 369.37 g/mol. Its IUPAC name is (2R)-5-amino-2-(methanesulfonamido)-N-[3-(trifluoromethoxy)phenyl]pentanamide.
| Compound Name | (2R)-5-amino-2-(methanesulfonamido)-N-[3-(trifluoromethoxy)phenyl]pentanamide |
|---|---|
| PubChem CID | 135386800 |
| Molecular Formula | C13H18F3N3O4S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (2R)-5-amino-2-(methanesulfonamido)-N-[3-(trifluoromethoxy)phenyl]pentanamide |
| SMILES | CS(=O)(=O)N[C@H](CCCN)C(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3N3O4S/c1-24(21,22)19-11(6-3-7-17)12(20)18-9-4-2-5-10(8-9)23-13(14,15)16/h2,4-5,8,11,19H,3,6-7,17H2,1H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | VSVMNOSMEGDWHE-LLVKDONJSA-N |
| XLogP | 1.18 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |