C13H16F3N3O3S — CID 55548634
2-(carbamoylamino)-4-methylsulfanyl-N-[3-(trifluoromethoxy)phenyl]butanamide (PubChem CID 55548634) has the molecular formula C13H16F3N3O3S and a molecular weight of 351.35 g/mol. Its IUPAC name is 2-(carbamoylamino)-4-methylsulfanyl-N-[3-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | 2-(carbamoylamino)-4-methylsulfanyl-N-[3-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 55548634 |
| Molecular Formula | C13H16F3N3O3S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-(carbamoylamino)-4-methylsulfanyl-N-[3-(trifluoromethoxy)phenyl]butanamide |
| SMILES | CSCCC(NC(N)=O)C(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3N3O3S/c1-23-6-5-10(19-12(17)21)11(20)18-8-3-2-4-9(7-8)22-13(14,15)16/h2-4,7,10H,5-6H2,1H3,(H,18,20)(H3,17,19,21) |
| InChIKey | TXWKVDNNWGTUAH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |