C9H7Cl2NO — CID 135387634
(5,7-dichloro-1H-indol-2-yl)methanol (PubChem CID 135387634) has the molecular formula C9H7Cl2NO and a molecular weight of 216.07 g/mol. Its IUPAC name is (5,7-dichloro-1H-indol-2-yl)methanol.
| Compound Name | (5,7-dichloro-1H-indol-2-yl)methanol |
|---|---|
| PubChem CID | 135387634 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | (5,7-dichloro-1H-indol-2-yl)methanol |
| SMILES | OCc1cc2cc(Cl)cc(Cl)c2[nH]1 |
| InChI | InChI=1S/C9H7Cl2NO/c10-6-1-5-2-7(4-13)12-9(5)8(11)3-6/h1-3,12-13H,4H2 |
| InChIKey | SAQAHYBXSKQBMR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |