C9H6Cl3NO — CID 82269577
(2,4,6-trichloro-1H-indol-3-yl)methanol (PubChem CID 82269577) has the molecular formula C9H6Cl3NO and a molecular weight of 250.51 g/mol. Its IUPAC name is (2,4,6-trichloro-1H-indol-3-yl)methanol.
| Compound Name | (2,4,6-trichloro-1H-indol-3-yl)methanol |
|---|---|
| PubChem CID | 82269577 |
| Molecular Formula | C9H6Cl3NO |
| Molecular Weight | 250.51 g/mol |
| Exact Mass | 248.95 |
| IUPAC Name | (2,4,6-trichloro-1H-indol-3-yl)methanol |
| SMILES | OCc1c(Cl)[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C9H6Cl3NO/c10-4-1-6(11)8-5(3-14)9(12)13-7(8)2-4/h1-2,13-14H,3H2 |
| InChIKey | QXJKNFJLHGCBFQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |