C12H11N5O2 — CID 135388663
4-methyl-6-(1-methylpyrazol-4-yl)-1H-pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 135388663) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-methyl-6-(1-methylpyrazol-4-yl)-1H-pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 4-methyl-6-(1-methylpyrazol-4-yl)-1H-pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 135388663 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-methyl-6-(1-methylpyrazol-4-yl)-1H-pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cn1cc(-c2ccc3[nH]c(=O)c(=O)n(C)c3n2)cn1 |
| InChI | InChI=1S/C12H11N5O2/c1-16-6-7(5-13-16)8-3-4-9-10(14-8)17(2)12(19)11(18)15-9/h3-6H,1-2H3,(H,15,18) |
| InChIKey | IVRPPGXOCNLESD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|