C19H14N4O3S — CID 135391701
N-(3-methylphenyl)-2-(5-nitrothiophen-2-yl)-3H-benzimidazole-5-carboxamide (PubChem CID 135391701) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-(5-nitrothiophen-2-yl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(3-methylphenyl)-2-(5-nitrothiophen-2-yl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 135391701 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-(3-methylphenyl)-2-(5-nitrothiophen-2-yl)-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2ccc3nc(-c4ccc([N+](=O)[O-])s4)[nH]c3c2)c1 |
| InChI | InChI=1S/C19H14N4O3S/c1-11-3-2-4-13(9-11)20-19(24)12-5-6-14-15(10-12)22-18(21-14)16-7-8-17(27-16)23(25)26/h2-10H,1H3,(H,20,24)(H,21,22) |
| InChIKey | KOUSKIIOZZVBQX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|