C23H15N5O5S — CID 52938853
N'-(3-hydroxynaphthalene-2-carbonyl)-2-(5-nitrothiophen-2-yl)-3H-benzimidazole-5-carbohydrazide (PubChem CID 52938853) has the molecular formula C23H15N5O5S and a molecular weight of 473.47 g/mol. Its IUPAC name is N'-(3-hydroxynaphthalene-2-carbonyl)-2-(5-nitrothiophen-2-yl)-3H-benzimidazole-5-carbohydrazide.
| Compound Name | N'-(3-hydroxynaphthalene-2-carbonyl)-2-(5-nitrothiophen-2-yl)-3H-benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 52938853 |
| Molecular Formula | C23H15N5O5S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N'-(3-hydroxynaphthalene-2-carbonyl)-2-(5-nitrothiophen-2-yl)-3H-benzimidazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc2ccccc2cc1O)c1ccc2nc(-c3ccc([N+](=O)[O-])s3)[nH]c2c1 |
| InChI | InChI=1S/C23H15N5O5S/c29-18-11-13-4-2-1-3-12(13)9-15(18)23(31)27-26-22(30)14-5-6-16-17(10-14)25-21(24-16)19-7-8-20(34-19)28(32)33/h1-11,29H,(H,24,25)(H,26,30)(H,27,31) |
| InChIKey | PHXFPHWLKFSKSV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|