C13H12N4O3S — CID 146582273
N-hydroxy-2-[5-(methoxyamino)thiophen-2-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 146582273) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is N-hydroxy-2-[5-(methoxyamino)thiophen-2-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-hydroxy-2-[5-(methoxyamino)thiophen-2-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146582273 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-hydroxy-2-[5-(methoxyamino)thiophen-2-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | CONc1ccc(-c2nc3ccc(C(=O)NO)cc3[nH]2)s1 |
| InChI | InChI=1S/C13H12N4O3S/c1-20-17-11-5-4-10(21-11)12-14-8-3-2-7(13(18)16-19)6-9(8)15-12/h2-6,17,19H,1H3,(H,14,15)(H,16,18) |
| InChIKey | OKGXACDDZBLWFV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|