C35H66NO4P — CID 135392030
2,6-ditert-butyl-4-[(4,4-diethoxybutylamino)-dihexylphosphorylmethyl]phenol (PubChem CID 135392030) has the molecular formula C35H66NO4P and a molecular weight of 595.89 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(4,4-diethoxybutylamino)-dihexylphosphorylmethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(4,4-diethoxybutylamino)-dihexylphosphorylmethyl]phenol |
|---|---|
| PubChem CID | 135392030 |
| Molecular Formula | C35H66NO4P |
| Molecular Weight | 595.89 g/mol |
| Exact Mass | 595.47 |
| IUPAC Name | 2,6-ditert-butyl-4-[(4,4-diethoxybutylamino)-dihexylphosphorylmethyl]phenol |
| SMILES | CCCCCCP(=O)(CCCCCC)C(NCCCC(OCC)OCC)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H66NO4P/c1-11-15-17-19-24-41(38,25-20-18-16-12-2)33(36-23-21-22-31(39-13-3)40-14-4)28-26-29(34(5,6)7)32(37)30(27-28)35(8,9)10/h26-27,31,33,36-37H,11-25H2,1-10H3 |
| InChIKey | RRTVCELSSNSLPX-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.89 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|