C9H8N4 — CID 135395473
2-(5-aminoimidazo[1,2-a]pyridin-2-yl)acetonitrile (PubChem CID 135395473) has the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-(5-aminoimidazo[1,2-a]pyridin-2-yl)acetonitrile.
| Compound Name | 2-(5-aminoimidazo[1,2-a]pyridin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 135395473 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-(5-aminoimidazo[1,2-a]pyridin-2-yl)acetonitrile |
| SMILES | N#CCc1cn2c(N)cccc2n1 |
| InChI | InChI=1S/C9H8N4/c10-5-4-7-6-13-8(11)2-1-3-9(13)12-7/h1-3,6H,4,11H2 |
| InChIKey | QNIVSICGPAOZDS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |