C8H7N3OS — CID 135396185
6-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyridin-2-one (PubChem CID 135396185) has the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. Its IUPAC name is 6-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyridin-2-one.
| Compound Name | 6-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 135396185 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 6-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyridin-2-one |
| SMILES | Cc1nnc(-c2cccc(=O)[nH]2)s1 |
| InChI | InChI=1S/C8H7N3OS/c1-5-10-11-8(13-5)6-3-2-4-7(12)9-6/h2-4H,1H3,(H,9,12) |
| InChIKey | NQOFDWAEEYZVRE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |