propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate

C12H13BrO3 — CID 135396958

IUPACpropan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate
SMILESCC(C)OC(=O)C1Cc2ccc(Br)cc2O1
InChIInChI=1S/C12H13BrO3/c1-7(2)15-12(14)11-5-8-3-4-9(13)6-10(8)16-11/h3-4,6-7,11H,5H2,1-2H3
InChIKeyXJVFFFYPPOQEBD-UHFFFAOYSA-N
MW285.14 g/mol
LogP2.70
Rot. Bonds2

About propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate

propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 135396958) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate.

Molecular Properties

Compound Namepropan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate
PubChem CID135396958
Molecular FormulaC12H13BrO3
Molecular Weight285.14 g/mol
Exact Mass284.00
IUPAC Namepropan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate
SMILESCC(C)OC(=O)C1Cc2ccc(Br)cc2O1
InChIInChI=1S/C12H13BrO3/c1-7(2)15-12(14)11-5-8-3-4-9(13)6-10(8)16-11/h3-4,6-7,11H,5H2,1-2H3
InChIKeyXJVFFFYPPOQEBD-UHFFFAOYSA-N
XLogP2.70
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.14
LogP ≤ 52.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate?
The IUPAC name of propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate (CID 135396958) is propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate.
What is the SMILES notation for propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate?
The canonical SMILES for propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate is CC(C)OC(=O)C1Cc2ccc(Br)cc2O1.
What is the InChIKey of propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate?
The InChIKey is XJVFFFYPPOQEBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO3/c1-7(2)15-12(14)11-5-8-3-4-9(13)6-10(8)16-11/h3-4,6-7,11H,5H2,1-2H3.
What are the key properties of propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate?
propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate has a molecular weight of 285.14 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate is sourced from PubChem (CID 135396958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).