C12H13BrO3 — CID 135396958
propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 135396958) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate.
| Compound Name | propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 135396958 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | propan-2-yl 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylate |
| SMILES | CC(C)OC(=O)C1Cc2ccc(Br)cc2O1 |
| InChI | InChI=1S/C12H13BrO3/c1-7(2)15-12(14)11-5-8-3-4-9(13)6-10(8)16-11/h3-4,6-7,11H,5H2,1-2H3 |
| InChIKey | XJVFFFYPPOQEBD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |