C8H4BrClN2 — CID 135397069
5-bromo-3-chloro-1,6-naphthyridine (PubChem CID 135397069) has the molecular formula C8H4BrClN2 and a molecular weight of 243.49 g/mol. Its IUPAC name is 5-bromo-3-chloro-1,6-naphthyridine.
| Compound Name | 5-bromo-3-chloro-1,6-naphthyridine |
|---|---|
| PubChem CID | 135397069 |
| Molecular Formula | C8H4BrClN2 |
| Molecular Weight | 243.49 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | 5-bromo-3-chloro-1,6-naphthyridine |
| SMILES | Clc1cnc2ccnc(Br)c2c1 |
| InChI | InChI=1S/C8H4BrClN2/c9-8-6-3-5(10)4-12-7(6)1-2-11-8/h1-4H |
| InChIKey | UNTZBRVMAOPMKP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|