C14H10ClNO — CID 143383552
3-chloro-6,7-bis(ethenyl)cyclohepta[b]pyridin-5-one (PubChem CID 143383552) has the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. Its IUPAC name is 3-chloro-6,7-bis(ethenyl)cyclohepta[b]pyridin-5-one.
| Compound Name | 3-chloro-6,7-bis(ethenyl)cyclohepta[b]pyridin-5-one |
|---|---|
| PubChem CID | 143383552 |
| Molecular Formula | C14H10ClNO |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 3-chloro-6,7-bis(ethenyl)cyclohepta[b]pyridin-5-one |
| SMILES | C=Cc1ccc2ncc(Cl)cc2c(=O)c1C=C |
| InChI | InChI=1S/C14H10ClNO/c1-3-9-5-6-13-12(7-10(15)8-16-13)14(17)11(9)4-2/h3-8H,1-2H2 |
| InChIKey | UDJLGILSXBFZGT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |