About 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane
3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane (PubChem CID 143383802) has the molecular formula C18H20ClNO
and a molecular weight of 301.82 g/mol. Its IUPAC name is 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane.
Molecular Properties
| Compound Name | 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane |
| PubChem CID | 143383802 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane |
| SMILES | C/C=C\c1ccc2ncc(Cl)cc2c(=O)c1/C=C\C.CC |
| InChI | InChI=1S/C16H14ClNO.C2H6/c1-3-5-11-7-8-15-14(9-12(17)10-18-15)16(19)13(11)6-4-2;1-2/h3-10H,1-2H3;1-2H3/b5-3-,6-4-; |
| InChIKey | HXPIEZDIQCOYTP-VIOUERSGSA-N |
| XLogP | 5.34 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane?
The IUPAC name of 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane (CID 143383802) is 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane.
What is the SMILES notation for 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane?
The canonical SMILES for 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane is C/C=C\c1ccc2ncc(Cl)cc2c(=O)c1/C=C\C.CC.
What is the InChIKey of 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane?
The InChIKey is HXPIEZDIQCOYTP-VIOUERSGSA-N. The full InChI is InChI=1S/C16H14ClNO.C2H6/c1-3-5-11-7-8-15-14(9-12(17)10-18-15)16(19)13(11)6-4-2;1-2/h3-10H,1-2H3;1-2H3/b5-3-,6-4-;.
What are the key properties of 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane?
3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane has a molecular weight of 301.82 g/mol, XLogP of 5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6,7-bis[(Z)-prop-1-enyl]cyclohepta[b]pyridin-5-one;ethane is sourced from PubChem (CID 143383802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).