About 2H-benzotriazol-4-ol
2H-benzotriazol-4-ol (PubChem CID 135399369) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 2H-benzotriazol-4-ol.
Molecular Properties
| Compound Name | 2H-benzotriazol-4-ol |
| PubChem CID | 135399369 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 2H-benzotriazol-4-ol |
| SMILES | Oc1cccc2n[nH]nc12 |
| InChI | InChI=1S/C6H5N3O/c10-5-3-1-2-4-6(5)8-9-7-4/h1-3,10H,(H,7,8,9) |
| InChIKey | JMTMSDXUXJISAY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-benzotriazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazol-4-ol?
The IUPAC name of 2H-benzotriazol-4-ol (CID 135399369) is 2H-benzotriazol-4-ol.
What is the SMILES notation for 2H-benzotriazol-4-ol?
The canonical SMILES for 2H-benzotriazol-4-ol is Oc1cccc2n[nH]nc12.
What is the InChIKey of 2H-benzotriazol-4-ol?
The InChIKey is JMTMSDXUXJISAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c10-5-3-1-2-4-6(5)8-9-7-4/h1-3,10H,(H,7,8,9).
What are the key properties of 2H-benzotriazol-4-ol?
2H-benzotriazol-4-ol has a molecular weight of 135.13 g/mol, XLogP of 0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazol-4-ol is sourced from PubChem (CID 135399369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).