About 2H-benzotriazol-4-ol;hydrate
2H-benzotriazol-4-ol;hydrate (PubChem CID 135761954) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is 2H-benzotriazol-4-ol;hydrate.
Molecular Properties
| Compound Name | 2H-benzotriazol-4-ol;hydrate |
| PubChem CID | 135761954 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 2H-benzotriazol-4-ol;hydrate |
| SMILES | O.Oc1cccc2n[nH]nc12 |
| InChI | InChI=1S/C6H5N3O.H2O/c10-5-3-1-2-4-6(5)8-9-7-4;/h1-3,10H,(H,7,8,9);1H2 |
| InChIKey | ZJSQZQMVXKZAGW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-benzotriazol-4-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazol-4-ol;hydrate?
The IUPAC name of 2H-benzotriazol-4-ol;hydrate (CID 135761954) is 2H-benzotriazol-4-ol;hydrate.
What is the SMILES notation for 2H-benzotriazol-4-ol;hydrate?
The canonical SMILES for 2H-benzotriazol-4-ol;hydrate is O.Oc1cccc2n[nH]nc12.
What is the InChIKey of 2H-benzotriazol-4-ol;hydrate?
The InChIKey is ZJSQZQMVXKZAGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O.H2O/c10-5-3-1-2-4-6(5)8-9-7-4;/h1-3,10H,(H,7,8,9);1H2.
What are the key properties of 2H-benzotriazol-4-ol;hydrate?
2H-benzotriazol-4-ol;hydrate has a molecular weight of 153.14 g/mol, XLogP of -0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazol-4-ol;hydrate is sourced from PubChem (CID 135761954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).