C30H29ClF3N5O8S — CID 135399830
2-(4-chloro-N-[4-[3-(dimethylamino)propoxy]phenyl]sulfonylanilino)-N-[(1-hydroxy-3-oxo-2H-isoquinolin-4-yl)imino]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 135399830) has the molecular formula C30H29ClF3N5O8S and a molecular weight of 712.10 g/mol. Its IUPAC name is 2-(4-chloro-N-[4-[3-(dimethylamino)propoxy]phenyl]sulfonylanilino)-N-[(1-hydroxy-3-oxo-2H-isoquinolin-4-yl)imino]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(4-chloro-N-[4-[3-(dimethylamino)propoxy]phenyl]sulfonylanilino)-N-[(1-hydroxy-3-oxo-2H-isoquinolin-4-yl)imino]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 135399830 |
| Molecular Formula | C30H29ClF3N5O8S |
| Molecular Weight | 712.10 g/mol |
| Exact Mass | 711.14 |
| IUPAC Name | 2-(4-chloro-N-[4-[3-(dimethylamino)propoxy]phenyl]sulfonylanilino)-N-[(1-hydroxy-3-oxo-2H-isoquinolin-4-yl)imino]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCCOc1ccc(S(=O)(=O)N(CC(=O)/N=N/c2c(=O)[nH]c(O)c3ccccc23)c2ccc(Cl)cc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H28ClN5O6S.C2HF3O2/c1-33(2)16-5-17-40-21-12-14-22(15-13-21)41(38,39)34(20-10-8-19(29)9-11-20)18-25(35)31-32-26-23-6-3-4-7-24(23)27(36)30-28(26)37;3-2(4,5)1(6)7/h3-4,6-15H,5,16-18H2,1-2H3,(H2,30,36,37);(H,6,7)/b32-31+; |
| InChIKey | RIQQBMHQQGWTAQ-MRRLHAJBSA-N |
| XLogP | 5.36 |
| TPSA | 182.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.10 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|