About ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate
ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate (PubChem CID 135403053) has the molecular formula C18H18N4O2
and a molecular weight of 322.37 g/mol. Its IUPAC name is ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate |
| PubChem CID | 135403053 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)cc2)c2c1CCc1[nH]ncc1-2 |
| InChI | InChI=1S/C18H18N4O2/c1-3-24-18(23)16-13-8-9-15-14(10-19-20-15)17(13)22(21-16)12-6-4-11(2)5-7-12/h4-7,10H,3,8-9H2,1-2H3,(H,19,20) |
| InChIKey | GBYHMRPMACWVTB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate?
The IUPAC name of ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate (CID 135403053) is ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate.
What is the SMILES notation for ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate?
The canonical SMILES for ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate is CCOC(=O)c1nn(-c2ccc(C)cc2)c2c1CCc1[nH]ncc1-2.
What is the InChIKey of ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate?
The InChIKey is GBYHMRPMACWVTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O2/c1-3-24-18(23)16-13-8-9-15-14(10-19-20-15)17(13)22(21-16)12-6-4-11(2)5-7-12/h4-7,10H,3,8-9H2,1-2H3,(H,19,20).
What are the key properties of ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate?
ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate has a molecular weight of 322.37 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(4-methylphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate is sourced from PubChem (CID 135403053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).