C8H11N5O2 — CID 135403820
2-amino-7,7-dimethyl-5,8-dihydro-3H-pteridine-4,6-dione (PubChem CID 135403820) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-amino-7,7-dimethyl-5,8-dihydro-3H-pteridine-4,6-dione.
| Compound Name | 2-amino-7,7-dimethyl-5,8-dihydro-3H-pteridine-4,6-dione |
|---|---|
| PubChem CID | 135403820 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-amino-7,7-dimethyl-5,8-dihydro-3H-pteridine-4,6-dione |
| SMILES | CC1(C)Nc2nc(N)[nH]c(=O)c2NC1=O |
| InChI | InChI=1S/C8H11N5O2/c1-8(2)6(15)10-3-4(13-8)11-7(9)12-5(3)14/h1-2H3,(H,10,15)(H4,9,11,12,13,14) |
| InChIKey | JMLQSLXEUWNWFI-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |