C11H15N5O2S2 — CID 136707557
2-amino-8-ethyl-6,7-bis(sulfanyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridin-4-one (PubChem CID 136707557) has the molecular formula C11H15N5O2S2 and a molecular weight of 313.41 g/mol. Its IUPAC name is 2-amino-8-ethyl-6,7-bis(sulfanyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridin-4-one.
| Compound Name | 2-amino-8-ethyl-6,7-bis(sulfanyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridin-4-one |
|---|---|
| PubChem CID | 136707557 |
| Molecular Formula | C11H15N5O2S2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-amino-8-ethyl-6,7-bis(sulfanyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridin-4-one |
| SMILES | CCC1OC2Nc3nc(N)[nH]c(=O)c3NC2C(S)=C1S |
| InChI | InChI=1S/C11H15N5O2S2/c1-2-3-6(19)7(20)4-10(18-3)14-8-5(13-4)9(17)16-11(12)15-8/h3-4,10,13,19-20H,2H2,1H3,(H4,12,14,15,16,17) |
| InChIKey | BGWXTTJWHHJUIP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|