C10H12MoN5O7PS3 — CID 139031809
(5aR,8R,9aR)-2-amino-4-oxo-8-(phosphonooxymethyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridine-6,7-dithiolate;oxo(sulfanylidene)molybdenum(2+) (PubChem CID 139031809) has the molecular formula C10H12MoN5O7PS3 and a molecular weight of 537.35 g/mol. Its IUPAC name is (5aR,8R,9aR)-2-amino-4-oxo-8-(phosphonooxymethyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridine-6,7-dithiolate;oxo(sulfanylidene)molybdenum(2+).
| Compound Name | (5aR,8R,9aR)-2-amino-4-oxo-8-(phosphonooxymethyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridine-6,7-dithiolate;oxo(sulfanylidene)molybdenum(2+) |
|---|---|
| PubChem CID | 139031809 |
| Molecular Formula | C10H12MoN5O7PS3 |
| Molecular Weight | 537.35 g/mol |
| Exact Mass | 538.87 |
| IUPAC Name | (5aR,8R,9aR)-2-amino-4-oxo-8-(phosphonooxymethyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridine-6,7-dithiolate;oxo(sulfanylidene)molybdenum(2+) |
| SMILES | Nc1nc2c(c(=O)[nH]1)N[C@H]1C([S-])=C([S-])[C@@H](COP(=O)(O)O)O[C@H]1N2.O=[Mo+2]=S |
| InChI | InChI=1S/C10H14N5O6PS2.Mo.O.S/c11-10-14-7-4(8(16)15-10)12-3-6(24)5(23)2(21-9(3)13-7)1-20-22(17,18)19;;;/h2-3,9,12,23-24H,1H2,(H2,17,18,19)(H4,11,13,14,15,16);;;/q;+2;;/p-2/t2-,3+,9-;;;/m1.../s1 |
| InChIKey | QNGJROMMAHOOFQ-JSUDGWJLSA-L |
| XLogP | -0.78 |
| TPSA | 188.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|